cas: 23616-15-1 — see every product listed under this CAS number, including other names
Methyl benzo[d][1,2,3]thiadiazole-5-carboxylate 98% (CAS 23616-15-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A312870-100mg |
| cas | 23616-15-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 248.00 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 715.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A312870 |
Methyl 1,2,3-benzothiadiazole-5-carboxylate (CAS 23616-15-1) is a chemical compound with the molecular formula C8H6N2O2S and a molecular weight of 194.21 g/mol. IUPAC name: methyl 1,2,3-benzothiadiazole-5-carboxylate. InChIKey: JCRFJMHWEAYQAA-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2S |
|---|---|
| Molecular weight | 194.21 g/mol |
| IUPAC name | methyl 1,2,3-benzothiadiazole-5-carboxylate |
| InChIKey | JCRFJMHWEAYQAA-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)SN=N2 |
Computed by PubChem (NCBI)