Methyl benzo[d][1,3]dioxole-4-carboxylate, 98%
cas: 33842-16-9 — see every product listed under this CAS number, including other names
Methyl benzo[d][1,3]dioxole-4-carboxylate, 98% (CAS 33842-16-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A116191-100mg |
| cas | 33842-16-9 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 387.06 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 328.40 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 469.86 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 143.72 Pln | |
| Fluorochem | 5g | 388.42 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 1,3-benzodioxole-4-carboxylate (CAS 33842-16-9) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: methyl 1,3-benzodioxole-4-carboxylate. InChIKey: KRPFJCUXHWEVMS-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | methyl 1,3-benzodioxole-4-carboxylate |
| InChIKey | KRPFJCUXHWEVMS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C1)OCO2 |
Computed by PubChem (NCBI)
Synonyms:
methyl benzo[d][1,3]dioxole-4-carboxylate, methyl 1,3-benzodioxole-4-carboxylate, methyl 2H-1,3-benzodioxole-4-carboxylate, 1,3-Benzodioxole-4-carboxylic acid, methyl ester, KRPFJCUXHWEVMS-UHFFFA, KRPFJCUXHWEVMS-UHFFFAOYSA-N, Methyl benzo[d][13]dioxole-4-carboxylate, methylbenzo[d][1,3]dioxole-4-carboxylate, benzo[1,3]dioxole-4-carboxylic acid methyl ester