cas: 128156-54-7 — see every product listed under this CAS number, including other names
Methyl benzo[d]oxazole-4-carboxylate 98% (CAS 128156-54-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A255440-250mg |
| cas | 128156-54-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 281.38 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2929.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A255440 |
Methyl 1,3-benzoxazole-4-carboxylate (CAS 128156-54-7) is a chemical compound with the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. IUPAC name: methyl 1,3-benzoxazole-4-carboxylate. InChIKey: XYHIHNFBMYROIE-UHFFFAOYSA-N.
| Molecular formula | C9H7NO3 |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | methyl 1,3-benzoxazole-4-carboxylate |
| InChIKey | XYHIHNFBMYROIE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C2C(=CC=C1)OC=N2 |
Computed by PubChem (NCBI)