cas: 154650-88-1 — see every product listed under this CAS number, including other names
Methyl thieno[2,3-b]pyridine-2-carboxylate 98% (CAS 154650-88-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A345594-100mg |
| cas | 154650-88-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 982.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A345594 |
Methyl thieno[2,3-b]pyridine-2-carboxylate (CAS 154650-88-1) is a chemical compound with the molecular formula C9H7NO2S and a molecular weight of 193.22 g/mol. IUPAC name: methyl thieno[2,3-b]pyridine-2-carboxylate. InChIKey: SUHXBEISAFXKIN-UHFFFAOYSA-N.
| Molecular formula | C9H7NO2S |
|---|---|
| Molecular weight | 193.22 g/mol |
| IUPAC name | methyl thieno[2,3-b]pyridine-2-carboxylate |
| InChIKey | SUHXBEISAFXKIN-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(S1)N=CC=C2 |
Computed by PubChem (NCBI)