CAS 2861190-30-7 appears in our catalog under these names: Mtb-IN-2/ 98.96% (existing batch purity), Mtb-IN-2. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1g, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
2-hydroxy-4-(quinoline-2-carbonylamino)benzoic acid (CAS 2861190-30-7) is a chemical compound with the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. IUPAC name: 2-hydroxy-4-(quinoline-2-carbonylamino)benzoic acid. InChIKey: WOVBYNARRLCBNS-UHFFFAOYSA-N.
| Molecular formula | C17H12N2O4 |
|---|---|
| Molecular weight | 308.29 g/mol |
| IUPAC name | 2-hydroxy-4-(quinoline-2-carbonylamino)benzoic acid |
| InChIKey | WOVBYNARRLCBNS-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=N2)C(=O)NC3=CC(=C(C=C3)C(=O)O)O |
Computed by PubChem (NCBI)