cas: 53672-99-4 — see every product listed under this CAS number, including other names
N-(2-AMINOETHYL)BENZENESULFONAMIDE HCL, 95% (CAS 53672-99-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F306280-250MG |
| cas | 53672-99-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 279.09 Pln | |
| Fluorochem | 1g | 643.54 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
N-(2-aminoethyl)benzenesulfonamide;hydrochloride (CAS 53672-99-4) is a chemical compound with the molecular formula C8H13ClN2O2S and a molecular weight of 236.72 g/mol. IUPAC name: N-(2-aminoethyl)benzenesulfonamide;hydrochloride. InChIKey: UMNPKLARCNEUAI-UHFFFAOYSA-N.
| Molecular formula | C8H13ClN2O2S |
|---|---|
| Molecular weight | 236.72 g/mol |
| IUPAC name | N-(2-aminoethyl)benzenesulfonamide;hydrochloride |
| InChIKey | UMNPKLARCNEUAI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)NCCN.Cl |
Computed by PubChem (NCBI)