cas: 45170-31-8 — see every product listed under this CAS number, including other names
N-[(1,1-Dimethylethoxy)carbonyl]-N-methyl-L-valine, 97%, 97% (CAS 45170-31-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I9HV-1g |
| cas | 45170-31-8 |
| size | 1g |
| availability | 3000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 131.60 Pln | |
| Chemat | 25g | 227.60 Pln | |
| Chemat | 100g | 664.40 Pln | |
| Chemat | 500g | 3004.80 Pln | |
| Chemat | 50g | 366.80 Pln | |
| Chemat | 250g | 1499.60 Pln | |
| Chemat | 1kg | 5229.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid (CAS 45170-31-8) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid. InChIKey: XPUAXAVJMJDPDH-QMMMGPOBSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | (2S)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoic acid |
| InChIKey | XPUAXAVJMJDPDH-QMMMGPOBSA-N |
| SMILES | CC(C)[C@@H](C(=O)O)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)