cas: 1217643-80-5 — see every product listed under this CAS number, including other names
N-BOC-2-(3'-CHLOROPHENYL)-L-GLYCINE, 98%, 98% (CAS 1217643-80-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 10g, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1126V1-100mg |
| cas | 1217643-80-5 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 10g | 1624.40 Pln | |
| Chemat | 250mg | 107.60 Pln | |
| Chemat | 1g | 237.20 Pln | |
| Chemat | 5g | 904.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 1217643-80-5) is a chemical compound with the molecular formula C13H16ClNO4 and a molecular weight of 285.72 g/mol. IUPAC name: (2S)-2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: BGMKFLAFNZFBBB-JTQLQIEISA-N.
| Molecular formula | C13H16ClNO4 |
|---|---|
| Molecular weight | 285.72 g/mol |
| IUPAC name | (2S)-2-(3-chlorophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | BGMKFLAFNZFBBB-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1=CC(=CC=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)