cas: 6094-36-6 — see every product listed under this CAS number, including other names
N-Benzoyl-L-glutamic Acid, >98.0%(HPLC)(T) (CAS 6094-36-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | B0202-1G |
| cas | 6094-36-6 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 98.68 Pln | |
| TCI | 25g | 354.37 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
(2S)-2-benzamidopentanedioic acid (CAS 6094-36-6) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: (2S)-2-benzamidopentanedioic acid. InChIKey: LPJXPACOXRZCCP-VIFPVBQESA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | (2S)-2-benzamidopentanedioic acid |
| InChIKey | LPJXPACOXRZCCP-VIFPVBQESA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)