CAS 6460-81-7 appears in our catalog under these names: 2-(Phenylformamido)pentanedioic acid, 95%, 2-(Benzoylamino)pentanedioic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g.
2-benzamidopentanedioic acid (CAS 6460-81-7) is a chemical compound with the molecular formula C12H13NO5 and a molecular weight of 251.23 g/mol. IUPAC name: 2-benzamidopentanedioic acid. InChIKey: LPJXPACOXRZCCP-UHFFFAOYSA-N.
| Molecular formula | C12H13NO5 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 2-benzamidopentanedioic acid |
| InChIKey | LPJXPACOXRZCCP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC(CCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)