cas: 405878-98-0 — see every product listed under this CAS number, including other names
N-Benzyl-2,2,2-trifluoroethanamine hydrochloride, 95% (CAS 405878-98-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A764413-100mg |
| cas | 405878-98-0 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 734.02 Pln | |
| AmBeed | 5g | 6163.36 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-benzyl-2,2,2-trifluoroethanamine;hydrochloride (CAS 405878-98-0) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: N-benzyl-2,2,2-trifluoroethanamine;hydrochloride. InChIKey: GOZGAFVDXDYLRF-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | N-benzyl-2,2,2-trifluoroethanamine;hydrochloride |
| InChIKey | GOZGAFVDXDYLRF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNCC(F)(F)F.Cl |
Computed by PubChem (NCBI)