cas: 53249-34-6 — see every product listed under this CAS number, including other names
N-Boc-4-Hydroxyphenyl-DL-glycine, 98% (CAS 53249-34-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F041041-100MG |
| cas | 53249-34-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 102.07 Pln | |
| Fluorochem | 250mg | 107.27 Pln | |
| Fluorochem | 1g | 122.89 Pln | |
| Fluorochem | 5g | 159.34 Pln | |
| Fluorochem | 25g | 372.80 Pln | |
| Fluorochem | 100g | 1060.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 53249-34-6) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: 2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: LRWJRIFKJPPAPM-UHFFFAOYSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | 2-(4-hydroxyphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | LRWJRIFKJPPAPM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)