cas: 57224-63-2 — see every product listed under this CAS number, including other names
N-Cbz-L-threonine methyl ester, 95% (CAS 57224-63-2) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222204-100G |
| cas | 57224-63-2 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 310.33 Pln | |
| Fluorochem | 500g | 1268.32 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (CAS 57224-63-2) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: methyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: OPZWAOJFQFYYIX-KOLCDFICSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | methyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | OPZWAOJFQFYYIX-KOLCDFICSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)