cas: 57224-63-2 — see every product listed under this CAS number, including other names
Z-Thr-OMe, 99.33% (CAS 57224-63-2) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 500 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W008297-100 g |
| cas | 57224-63-2 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 435.79 Pln | |
| MedChemExpress | 500 g | 1703.60 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.33% |
Methyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate (CAS 57224-63-2) is a chemical compound with the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. IUPAC name: methyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate. InChIKey: OPZWAOJFQFYYIX-KOLCDFICSA-N.
| Molecular formula | C13H17NO5 |
|---|---|
| Molecular weight | 267.28 g/mol |
| IUPAC name | methyl (2S,3R)-3-hydroxy-2-(phenylmethoxycarbonylamino)butanoate |
| InChIKey | OPZWAOJFQFYYIX-KOLCDFICSA-N |
| SMILES | C[C@H]([C@@H](C(=O)OC)NC(=O)OCC1=CC=CC=C1)O |
Computed by PubChem (NCBI)