cas: 103984-27-6 — see every product listed under this CAS number, including other names
N-Methyl-1-phenyl-1H-pyrazolo[3,4-d]pyrimidin-4-amine, 95%, 95% (CAS 103984-27-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12A0XJ-100mg |
| cas | 103984-27-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1096.40 Pln | |
| Chemat | 1g | 2128.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
N-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine (CAS 103984-27-6) is a chemical compound with the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. IUPAC name: N-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine. InChIKey: ZRRSRZDWRAGYSZ-UHFFFAOYSA-N.
| Molecular formula | C12H11N5 |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | N-methyl-1-phenylpyrazolo[3,4-d]pyrimidin-4-amine |
| InChIKey | ZRRSRZDWRAGYSZ-UHFFFAOYSA-N |
| SMILES | CNC1=C2C=NN(C2=NC=N1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)