cas: 166943-39-1 — see every product listed under this CAS number, including other names
N-Methyl-4-nitrophenethylamine hydrochloride, 97%, 97% (CAS 166943-39-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g, 10g, 50g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112X28-250mg |
| cas | 166943-39-1 |
| size | 250mg |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 78.80 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 25g | 198.80 Pln | |
| Chemat | 100g | 544.40 Pln | |
| Chemat | 10g | 122.00 Pln | |
| Chemat | 50g | 318.80 Pln | |
| Chemat | 250g | 1216.40 Pln | |
| Chemat | 500g | 2337.60 Pln | |
| Chemat | 1kg | 4178.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride (CAS 166943-39-1) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride. InChIKey: VGJDSNZOPPZCTB-UHFFFAOYSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | N-methyl-2-(4-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | VGJDSNZOPPZCTB-UHFFFAOYSA-N |
| SMILES | CNCCC1=CC=C(C=C1)[N+](=O)[O-].Cl |
Computed by PubChem (NCBI)