cas: 198275-79-5 — see every product listed under this CAS number, including other names
N-Phenyl-3-biphenylamine, 99%, 99% (CAS 198275-79-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g, 50g, 75g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113BE6-250mg |
| cas | 198275-79-5 |
| size | 250mg |
| availability | 300g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 117.20 Pln | |
| Chemat | 5g | 309.20 Pln | |
| Chemat | 10g | 549.20 Pln | |
| Chemat | 15g | 774.80 Pln | |
| Chemat | 25g | 1134.80 Pln | |
| Chemat | 50g | 2099.60 Pln | |
| Chemat | 75g | 3083.60 Pln | |
| Chemat | 100g | 3390.80 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N,3-diphenylaniline (CAS 198275-79-5) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: N,3-diphenylaniline. InChIKey: QJAYWJUCAONYLG-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | N,3-diphenylaniline |
| InChIKey | QJAYWJUCAONYLG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)