cas: 537-65-5 — see every product listed under this CAS number, including other names
N1-(4-Aminophenyl)benzene-1,4-diamine, 95%, 95% (CAS 537-65-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DDRC-1g |
| cas | 537-65-5 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 194.00 Pln | |
| Chemat | 10g | 323.60 Pln | |
| Chemat | 25g | 702.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
4-N-(4-aminophenyl)benzene-1,4-diamine (CAS 537-65-5) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 4-N-(4-aminophenyl)benzene-1,4-diamine. InChIKey: QZHXKQKKEBXYRG-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 4-N-(4-aminophenyl)benzene-1,4-diamine |
| InChIKey | QZHXKQKKEBXYRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)NC2=CC=C(C=C2)N |
Computed by PubChem (NCBI)