cas: 79707-12-3 — see every product listed under this CAS number, including other names
N3-Benzylpyridine-2,3-diamine, 95+%, 95+% (CAS 79707-12-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ILP-100mg |
| cas | 79707-12-3 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 366.80 Pln | |
| Chemat | 250mg | 611.60 Pln | |
| Chemat | 1g | 1538.00 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
3-N-benzylpyridine-2,3-diamine (CAS 79707-12-3) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-N-benzylpyridine-2,3-diamine. InChIKey: MUKAGFLFIMVSQN-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-N-benzylpyridine-2,3-diamine |
| InChIKey | MUKAGFLFIMVSQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(N=CC=C2)N |
Computed by PubChem (NCBI)