cas: 75115-28-5 — see every product listed under this CAS number, including other names
N3-Benzylpyridine-3,4-diamine 95% (CAS 75115-28-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A146605-250mg |
| cas | 75115-28-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 987.81 Pln | |
| Ambeed | 1g | 2806.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A146605 |
3-N-benzylpyridine-3,4-diamine (CAS 75115-28-5) is a chemical compound with the molecular formula C12H13N3 and a molecular weight of 199.25 g/mol. IUPAC name: 3-N-benzylpyridine-3,4-diamine. InChIKey: SELGUEJXCMDJLV-UHFFFAOYSA-N.
| Molecular formula | C12H13N3 |
|---|---|
| Molecular weight | 199.25 g/mol |
| IUPAC name | 3-N-benzylpyridine-3,4-diamine |
| InChIKey | SELGUEJXCMDJLV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CNC2=C(C=CN=C2)N |
Computed by PubChem (NCBI)