CAS 181427-78-1 appears in our catalog under these names: NM–3, NM-3/ 99.89% (existing batch purity), NM-3. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
2-(8-hydroxy-6-methoxy-1-oxoisochromen-3-yl)propanoic acid (CAS 181427-78-1) is a chemical compound with the molecular formula C13H12O6 and a molecular weight of 264.23 g/mol. IUPAC name: 2-(8-hydroxy-6-methoxy-1-oxoisochromen-3-yl)propanoic acid. InChIKey: BPZCXUROMKDLGX-UHFFFAOYSA-N.
| Molecular formula | C13H12O6 |
|---|---|
| Molecular weight | 264.23 g/mol |
| IUPAC name | 2-(8-hydroxy-6-methoxy-1-oxoisochromen-3-yl)propanoic acid |
| InChIKey | BPZCXUROMKDLGX-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=CC(=CC(=C2C(=O)O1)O)OC)C(=O)O |
Computed by PubChem (NCBI)