Products 907957-34-0
CAS 907957-34-0 appears in our catalog under these names: NSC 694623/ 99.87% (existing batch purity), NSC 694623, NSC 694623 99%, NSC 694623, NSC 694623, 99.53%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g.
2-(4-butylphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one (CAS 907957-34-0) is a chemical compound with the molecular formula C16H16N2OS and a molecular weight of 284.4 g/mol. IUPAC name: 2-(4-butylphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one. InChIKey: XNGPPEMGIZDPGJ-UHFFFAOYSA-N.
| Molecular formula | C16H16N2OS |
|---|---|
| Molecular weight | 284.4 g/mol |
| IUPAC name | 2-(4-butylphenyl)-[1,2]thiazolo[5,4-b]pyridin-3-one |
| InChIKey | XNGPPEMGIZDPGJ-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC=C(C=C1)N2C(=O)C3=C(S2)N=CC=C3 |
Computed by PubChem (NCBI)