CAS 83280-65-3 appears in our catalog under these names: 2-Acetylfuro-1,4-Naphthoquinone, Napabucasin, Napabucasin/ 99.35% (existing batch purity), 2-Acetylnaphtho[2,3-b]furan-4,9-dione, >98.0%(GC), Naphtho[2,3-b]furan-4,9-dione, 2-acetyl-, 98%, 98%. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 250mg, 5mg, 10mg, 50mg, 100mg, 1g, 25mg.
2-acetylbenzo[f][1]benzofuran-4,9-dione (CAS 83280-65-3) is a chemical compound with the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. IUPAC name: 2-acetylbenzo[f][1]benzofuran-4,9-dione. InChIKey: DPHUWDIXHNQOSY-UHFFFAOYSA-N.
| Molecular formula | C14H8O4 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 2-acetylbenzo[f][1]benzofuran-4,9-dione |
| InChIKey | DPHUWDIXHNQOSY-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(O1)C(=O)C3=CC=CC=C3C2=O |
Computed by PubChem (NCBI)