cas: 16837-38-0 — see every product listed under this CAS number, including other names
Nicotinic anhydride (CAS 16837-38-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211329-250MG |
| cas | 16837-38-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 315.53 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 2320.03 Pln | |
| Fluorochem | 25g | 5173.20 Pln |
| delivery time | 3-4 weeks |
|---|
Pyridine-3-carbonyl pyridine-3-carboxylate (CAS 16837-38-0) is a chemical compound with the molecular formula C12H8N2O3 and a molecular weight of 228.20 g/mol. IUPAC name: pyridine-3-carbonyl pyridine-3-carboxylate. InChIKey: VPODXHOUBDCEHN-UHFFFAOYSA-N.
| Molecular formula | C12H8N2O3 |
|---|---|
| Molecular weight | 228.20 g/mol |
| IUPAC name | pyridine-3-carbonyl pyridine-3-carboxylate |
| InChIKey | VPODXHOUBDCEHN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)C(=O)OC(=O)C2=CN=CC=C2 |
Computed by PubChem (NCBI)