Products 1310744-67-2
CAS 1310744-67-2 appears in our catalog under these names: PFM39/ 98.98% (existing batch purity), PFM39, PFM39, 99.01%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 100mg, 25mg, 50mg, 5mg, 10 mg, 10mM/1mL, 100 mg.
(5Z)-5-[(4-aminophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one (CAS 1310744-67-2) is a chemical compound with the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. IUPAC name: (5Z)-5-[(4-aminophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one. InChIKey: QXOIZYPBCJHYLN-YVMONPNESA-N.
| Molecular formula | C10H9N3OS |
|---|---|
| Molecular weight | 219.27 g/mol |
| IUPAC name | (5Z)-5-[(4-aminophenyl)methylidene]-2-imino-1,3-thiazolidin-4-one |
| InChIKey | QXOIZYPBCJHYLN-YVMONPNESA-N |
| SMILES | C1=CC(=CC=C1/C=C\2/C(=O)NC(=N)S2)N |
Computed by PubChem (NCBI)