cas: 1333317-99-9 — see every product listed under this CAS number, including other names
PTAA (CAS 1333317-99-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P3179-250MG |
| cas | 1333317-99-9 |
| size | 250mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 250mg | 1121.46 Pln | |
| TCI | 1g | 4258.67 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | 0 |
2,4,6-trimethyl-N,N-diphenylaniline (CAS 1333317-99-9) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: 2,4,6-trimethyl-N,N-diphenylaniline. InChIKey: TZJRFZZCRASCAW-UHFFFAOYSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 2,4,6-trimethyl-N,N-diphenylaniline |
| InChIKey | TZJRFZZCRASCAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N(C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)