cas: 1333317-99-9 — see every product listed under this CAS number, including other names
Poly[[(2,4,6-trimethylphenyl)imino][1,1'-biphenyl]-4,4'-diyl] (CAS 1333317-99-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 500mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110XQV-25mg |
| cas | 1333317-99-9 |
| size | 25mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 376.40 Pln | |
| Chemat | 50mg | 386.00 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1360.40 Pln | |
| Chemat | 500mg | 2056.40 Pln | |
| Chemat | 1g | 3909.20 Pln |
| delivery time | 3 weeks |
|---|
2,4,6-trimethyl-N,N-diphenylaniline (CAS 1333317-99-9) is a chemical compound with the molecular formula C21H21N and a molecular weight of 287.4 g/mol. IUPAC name: 2,4,6-trimethyl-N,N-diphenylaniline. InChIKey: TZJRFZZCRASCAW-UHFFFAOYSA-N.
| Molecular formula | C21H21N |
|---|---|
| Molecular weight | 287.4 g/mol |
| IUPAC name | 2,4,6-trimethyl-N,N-diphenylaniline |
| InChIKey | TZJRFZZCRASCAW-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)N(C2=CC=CC=C2)C3=CC=CC=C3)C |
Computed by PubChem (NCBI)