CAS 88040-00-0 is the registry number for 3-Phenyl-2H-chromen-7-ol, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-phenyl-2H-chromen-7-ol (CAS 88040-00-0) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: 3-phenyl-2H-chromen-7-ol. InChIKey: LHEPASGAURDEKQ-UHFFFAOYSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | 3-phenyl-2H-chromen-7-ol |
| InChIKey | LHEPASGAURDEKQ-UHFFFAOYSA-N |
| SMILES | C1C(=CC2=C(O1)C=C(C=C2)O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)