cas: 376581-24-7 — see every product listed under this CAS number, including other names
Quinolin-6-ylboronic acid 97% (CAS 376581-24-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A188481-250mg |
| cas | 376581-24-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 275.81 Pln | |
| Ambeed | 10g | 414.88 Pln | |
| Ambeed | 25g | 926.62 Pln | |
| Ambeed | 100g | 3185.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A188481 |
Quinolin-6-ylboronic acid (CAS 376581-24-7) is a chemical compound with the molecular formula C9H8BNO2 and a molecular weight of 172.98 g/mol. IUPAC name: quinolin-6-ylboronic acid. InChIKey: JLOLSBLXNMVKGY-UHFFFAOYSA-N.
| Molecular formula | C9H8BNO2 |
|---|---|
| Molecular weight | 172.98 g/mol |
| IUPAC name | quinolin-6-ylboronic acid |
| InChIKey | JLOLSBLXNMVKGY-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(C=C1)N=CC=C2)(O)O |
Computed by PubChem (NCBI)