cas: 18704-37-5 — see every product listed under this CAS number, including other names
Quinoline-8-sulfonyl Chloride, >98.0%(T) (CAS 18704-37-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | Q0016-5G |
| cas | 18704-37-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 331.28 Pln | |
| TCI | 25g | 827.92 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T) |
Quinoline-8-sulfonyl chloride (CAS 18704-37-5) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: quinoline-8-sulfonyl chloride. InChIKey: JUYUYCIJACTHMK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | quinoline-8-sulfonyl chloride |
| InChIKey | JUYUYCIJACTHMK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)Cl)N=CC=C2 |
Computed by PubChem (NCBI)