cas: 18704-37-5 — see every product listed under this CAS number, including other names
Quinoline-8-sulfonyl chloride, 98.00% (CAS 18704-37-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM95570K-10g |
| cas | 18704-37-5 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 435.46 Pln | |
| Chemat | 25g | 813.10 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
Quinoline-8-sulfonyl chloride (CAS 18704-37-5) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: quinoline-8-sulfonyl chloride. InChIKey: JUYUYCIJACTHMK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | quinoline-8-sulfonyl chloride |
| InChIKey | JUYUYCIJACTHMK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)Cl)N=CC=C2 |
Computed by PubChem (NCBI)