cas: 18704-37-5 — see every product listed under this CAS number, including other names
Quinoline-8-sulfonyl chloride, 98%, 98% (CAS 18704-37-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118S6M-1g |
| cas | 18704-37-5 |
| size | 1g |
| availability | 600g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 93.20 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 222.80 Pln | |
| Chemat | 100g | 722.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Quinoline-8-sulfonyl chloride (CAS 18704-37-5) is a chemical compound with the molecular formula C9H6ClNO2S and a molecular weight of 227.67 g/mol. IUPAC name: quinoline-8-sulfonyl chloride. InChIKey: JUYUYCIJACTHMK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO2S |
|---|---|
| Molecular weight | 227.67 g/mol |
| IUPAC name | quinoline-8-sulfonyl chloride |
| InChIKey | JUYUYCIJACTHMK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)S(=O)(=O)Cl)N=CC=C2 |
Computed by PubChem (NCBI)