Products 1043491-54-8
CAS 1043491-54-8 appears in our catalog under these names: RO5203648 HCl/ 98.02% (existing batch purity), RO5203648, (4S)-4-(3,4-Dichlorophenyl)-4,5-dihydro-2-oxazolamine, RO5203648, ≥98%, ≥98%, RO5203648, 98.10%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 5 mg.
(4S)-4-(3,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine (CAS 1043491-54-8) is a chemical compound with the molecular formula C9H8Cl2N2O and a molecular weight of 231.08 g/mol. IUPAC name: (4S)-4-(3,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine. InChIKey: HGGPGNSCBBAGJN-MRVPVSSYSA-N.
| Molecular formula | C9H8Cl2N2O |
|---|---|
| Molecular weight | 231.08 g/mol |
| IUPAC name | (4S)-4-(3,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| InChIKey | HGGPGNSCBBAGJN-MRVPVSSYSA-N |
| SMILES | C1[C@@H](N=C(O1)N)C2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)