CAS 796115-75-8 appears in our catalog under these names: STK414603/ 99.29% (existing batch purity), STK414603, 2-(2-Chlorophenyl)-N-(thiazol-2-yl)acetamide, 98%, 98%, Analgesic agent-3. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 50 mg, 5 mg.
2-(2-chlorophenyl)-N-(1,3-thiazol-2-yl)acetamide (CAS 796115-75-8) is a chemical compound with the molecular formula C11H9ClN2OS and a molecular weight of 252.72 g/mol. IUPAC name: 2-(2-chlorophenyl)-N-(1,3-thiazol-2-yl)acetamide. InChIKey: FLITWEQVHZUSRH-UHFFFAOYSA-N.
| Molecular formula | C11H9ClN2OS |
|---|---|
| Molecular weight | 252.72 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-N-(1,3-thiazol-2-yl)acetamide |
| InChIKey | FLITWEQVHZUSRH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CC(=O)NC2=NC=CS2)Cl |
Computed by PubChem (NCBI)