cas: 36411-52-6 — see every product listed under this CAS number, including other names
Salicyloylaminotriazole, 95%, 95% (CAS 36411-52-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 25g, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BXFH-100mg |
| cas | 36411-52-6 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 25g | 2123.60 Pln | |
| Chemat | 1g | 266.00 Pln | |
| Chemat | 5g | 746.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide (CAS 36411-52-6) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide. InChIKey: MZZYGYNZAOVRTG-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 2-hydroxy-N-(1H-1,2,4-triazol-5-yl)benzamide |
| InChIKey | MZZYGYNZAOVRTG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)NC2=NC=NN2)O |
Computed by PubChem (NCBI)