Stachydrine (hydrochloride), 99.82%
cas: 4136-37-2 — see every product listed under this CAS number, including other names
Stachydrine (hydrochloride), 99.82% (CAS 4136-37-2) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 100 mg, 10 mg, 25 mg, 50 mg, 5 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-N0738-10mM/1mL |
| cas | 4136-37-2 |
| size | 10mM/1mL |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 407.93 Pln | |
| MedChemExpress | 100 mg | 1318.15 Pln | |
| MedChemExpress | 10 mg | 505.45 Pln | |
| MedChemExpress | 25 mg | 770.16 Pln | |
| MedChemExpress | 50 mg | 1034.87 Pln | |
| MedChemExpress | 5 mg | 384.71 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.82% |
(2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride (CAS 4136-37-2) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride. InChIKey: DUNMULOWUUIQIL-RGMNGODLSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride |
| InChIKey | DUNMULOWUUIQIL-RGMNGODLSA-N |
| SMILES | C[N+]1(CCC[C@H]1C(=O)O)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
stachydrine chloride, Stachydrine HCl, (S)-2-Carboxy-1,1-dimethylpyrrolidin-1-ium chloride, Pyrrolidinium, 2-carboxy-1,1-dimethyl-, chloride, (S)-, (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid;chloride, orb1222276, orb1304382, orb3140805, Stachydrine hydrochloride (Standard), (2R,4R)-4-Hydroxy-1,1-dimethyl-2-pyrrolidiniumcarboxylate hydrochloride