cas: 4136-37-2 — see every product listed under this CAS number, including other names
Stachydrine hydrochloride, 90% (extraction,racemate), 90% (extraction,racemate) (CAS 4136-37-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ILKM-250mg |
| cas | 4136-37-2 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 69.20 Pln | |
| Chemat | 1g | 74.00 Pln |
| purity | 90% (extraction,racemate) |
|---|---|
| delivery time | 3 weeks |
(2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride (CAS 4136-37-2) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride. InChIKey: DUNMULOWUUIQIL-RGMNGODLSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride |
| InChIKey | DUNMULOWUUIQIL-RGMNGODLSA-N |
| SMILES | C[N+]1(CCC[C@H]1C(=O)O)C.[Cl-] |
Computed by PubChem (NCBI)