CAS 4136-37-2 appears in our catalog under these names: Stachydrine hydrochloride, 95%, Stachydrine Chloride, >95% (HPLC), Stachydrine Hydrochloride/ 98.45% (existing batch purity), Stachydrine (hydrochloride), Stachydrine hydrochloride, 95.00%. Offered by: Combi-blocks, TRC, TargetMol, GLPBio, Chemat. Available pack sizes: 25g, 1g, 5g, 100g, 100mg, 10mg, 50mg, 250mg.
(2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride (CAS 4136-37-2) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride. InChIKey: DUNMULOWUUIQIL-RGMNGODLSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride |
| InChIKey | DUNMULOWUUIQIL-RGMNGODLSA-N |
| SMILES | C[N+]1(CCC[C@H]1C(=O)O)C.[Cl-] |
Computed by PubChem (NCBI)