Stachydrine HCl 90% （extraction,racemate）
cas: 4136-37-2 — see every product listed under this CAS number, including other names
Stachydrine HCl 90% （extraction,racemate） (CAS 4136-37-2) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 50mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A556286-1mg |
| cas | 4136-37-2 |
| size | 1mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 120.06 Pln | |
| Ambeed | 50mg | 131.19 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 25g | 220.19 Pln | |
| Ambeed | 100g | 320.31 Pln |
properties
| purity | 90% （extraction,racemate） |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A556286 |
(2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride (CAS 4136-37-2) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride. InChIKey: DUNMULOWUUIQIL-RGMNGODLSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid chloride |
| InChIKey | DUNMULOWUUIQIL-RGMNGODLSA-N |
| SMILES | C[N+]1(CCC[C@H]1C(=O)O)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
stachydrine chloride, Stachydrine HCl, (S)-2-Carboxy-1,1-dimethylpyrrolidin-1-ium chloride, Pyrrolidinium, 2-carboxy-1,1-dimethyl-, chloride, (S)-, (2S)-1,1-dimethylpyrrolidin-1-ium-2-carboxylic acid;chloride, orb1222276, orb1304382, orb3140805, Stachydrine hydrochloride (Standard), (2R,4R)-4-Hydroxy-1,1-dimethyl-2-pyrrolidiniumcarboxylate hydrochloride