CAS 327033-36-3 appears in our catalog under these names: TCS-PIM-1-4a/ 99.89% (existing batch purity), TCS–PIM–1–4a, SMI-4a, 5-([3-(Trifluoromethyl)phenyl]methylidene)-1,3-thiazolidine-2,4-dione. Offered by: TargetMol, GLPBio, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
(5E)-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (CAS 327033-36-3) is a chemical compound with the molecular formula C11H6F3NO2S and a molecular weight of 273.23 g/mol. IUPAC name: (5E)-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione. InChIKey: NGJLOFCOEOHFKQ-VMPITWQZSA-N.
| Molecular formula | C11H6F3NO2S |
|---|---|
| Molecular weight | 273.23 g/mol |
| IUPAC name | (5E)-5-[[3-(trifluoromethyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| InChIKey | NGJLOFCOEOHFKQ-VMPITWQZSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)/C=C/2\C(=O)NC(=O)S2 |
Computed by PubChem (NCBI)