cas: 1956321-27-9 — see every product listed under this CAS number, including other names
TERT-BUTYL 4,6-DICHLORONICOTINATE, 98% (CAS 1956321-27-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F530191-250MG |
| cas | 1956321-27-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 424.87 Pln | |
| Fluorochem | 1g | 1034.03 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 4,6-dichloropyridine-3-carboxylate (CAS 1956321-27-9) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: tert-butyl 4,6-dichloropyridine-3-carboxylate. InChIKey: XPAVOQSQZMCRRR-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | tert-butyl 4,6-dichloropyridine-3-carboxylate |
| InChIKey | XPAVOQSQZMCRRR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CN=C(C=C1Cl)Cl |
Computed by PubChem (NCBI)