Products 453590-24-4
CAS 453590-24-4 appears in our catalog under these names: 6-(4-Methoxyphenyl)furo(2,3-d)pyrimidin-4-amine, 6-(4-Methoxyphenyl)furo[2,3-d]pyrimidin-4-amine, 98%, 98%, TIE–2/VEGFR–2 kinase–IN–1, TIE-2/VEGFR-2 kinase-IN-1, 99.91%. Offered by: Biosynth, Chemat, GLPBio, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 1mg, 10mM (in 1ml dmso), 25 mg, 5 mg.
6-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine (CAS 453590-24-4) is a chemical compound with the molecular formula C13H11N3O2 and a molecular weight of 241.24 g/mol. IUPAC name: 6-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine. InChIKey: DIJLFIHLUYAZCI-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O2 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 6-(4-methoxyphenyl)furo[2,3-d]pyrimidin-4-amine |
| InChIKey | DIJLFIHLUYAZCI-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC3=C(N=CN=C3O2)N |
Computed by PubChem (NCBI)