cas: 75308-46-2 — see every product listed under this CAS number, including other names
Tert-Butyl 2,6-Dichloroisonicotinate, 97%, 97% (CAS 75308-46-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114UJ8-250mg |
| cas | 75308-46-2 |
| size | 250mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 10g | 208.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,6-dichloropyridine-4-carboxylate (CAS 75308-46-2) is a chemical compound with the molecular formula C10H11Cl2NO2 and a molecular weight of 248.10 g/mol. IUPAC name: tert-butyl 2,6-dichloropyridine-4-carboxylate. InChIKey: PLRVIRHWKQKSAK-UHFFFAOYSA-N.
| Molecular formula | C10H11Cl2NO2 |
|---|---|
| Molecular weight | 248.10 g/mol |
| IUPAC name | tert-butyl 2,6-dichloropyridine-4-carboxylate |
| InChIKey | PLRVIRHWKQKSAK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=NC(=C1)Cl)Cl |
Computed by PubChem (NCBI)