cas: 1339524-27-4 — see every product listed under this CAS number, including other names
Tert-butyl 2,3-difluorobenzoate, ≥95%, ≥95% (CAS 1339524-27-4) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12K24F-1g |
| cas | 1339524-27-4 |
| size | 1g |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 1043.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,3-difluorobenzoate (CAS 1339524-27-4) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: tert-butyl 2,3-difluorobenzoate. InChIKey: JIQHQAHVSQGLSI-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | tert-butyl 2,3-difluorobenzoate |
| InChIKey | JIQHQAHVSQGLSI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=CC=C1)F)F |
Computed by PubChem (NCBI)