cas: 1339524-27-4 — see every product listed under this CAS number, including other names
tert-Butyl 2,3-difluorobenzoate, 97% (CAS 1339524-27-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A370488-25g |
| cas | 1339524-27-4 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 19196.38 Pln | |
| AmBeed | 10g | 9802.45 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 2,3-difluorobenzoate (CAS 1339524-27-4) is a chemical compound with the molecular formula C11H12F2O2 and a molecular weight of 214.21 g/mol. IUPAC name: tert-butyl 2,3-difluorobenzoate. InChIKey: JIQHQAHVSQGLSI-UHFFFAOYSA-N.
| Molecular formula | C11H12F2O2 |
|---|---|
| Molecular weight | 214.21 g/mol |
| IUPAC name | tert-butyl 2,3-difluorobenzoate |
| InChIKey | JIQHQAHVSQGLSI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=CC=C1)F)F |
Computed by PubChem (NCBI)