CAS 16692-52-7 appears in our catalog under these names: Tetramethylkaempferol/ 99.65% (existing batch purity), Tetramethylkaempferol, 3,5,7,4'-Tetramethoxyflavone, Tetramethylkaempferol, 99.93%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 2mg, 20mg.
3,5,7-trimethoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 16692-52-7) is a chemical compound with the molecular formula C19H18O6 and a molecular weight of 342.3 g/mol. IUPAC name: 3,5,7-trimethoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: YZWIIEJLESXODL-UHFFFAOYSA-N.
| Molecular formula | C19H18O6 |
|---|---|
| Molecular weight | 342.3 g/mol |
| IUPAC name | 3,5,7-trimethoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | YZWIIEJLESXODL-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=C(C(=O)C3=C(O2)C=C(C=C3OC)OC)OC |
Computed by PubChem (NCBI)