cas: 220352-36-3 — see every product listed under this CAS number, including other names
Ticagrelor impurity 11 98% (CAS 220352-36-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A519229-250mg |
| cas | 220352-36-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 387.06 Pln | |
| Ambeed | 1g | 921.06 Pln | |
| Ambeed | 5g | 2695.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A519229 |
Trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid (CAS 220352-36-3) is a chemical compound with the molecular formula C10H8F2O2 and a molecular weight of 198.17 g/mol. IUPAC name: trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: CSLVZAGSOJLXCT-NKWVEPMBSA-N.
| Molecular formula | C10H8F2O2 |
|---|---|
| Molecular weight | 198.17 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,4-difluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | CSLVZAGSOJLXCT-NKWVEPMBSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=C(C=C2)F)F |
Computed by PubChem (NCBI)