cas: 17832-16-5 — see every product listed under this CAS number, including other names
Triallyl 1,3,5-Benzenetricarboxylate (CAS 17832-16-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1136YC-100mg |
| cas | 17832-16-5 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 155.60 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 400.40 Pln |
| delivery time | 3 weeks |
|---|
Tris(prop-2-enyl) benzene-1,3,5-tricarboxylate (CAS 17832-16-5) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: tris(prop-2-enyl) benzene-1,3,5-tricarboxylate. InChIKey: VOSUIKFOFHZNED-UHFFFAOYSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | tris(prop-2-enyl) benzene-1,3,5-tricarboxylate |
| InChIKey | VOSUIKFOFHZNED-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)C1=CC(=CC(=C1)C(=O)OCC=C)C(=O)OCC=C |
Computed by PubChem (NCBI)