Products 1291087-13-2
CAS 1291087-13-2 is the registry number for 4-(1-(2,2-Dimethyl-4,6-dioxo-1,3-dioxan-5-yl)but-2-yn-1-yl)phenyl acetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[4-[1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)but-2-ynyl]phenyl] acetate (CAS 1291087-13-2) is a chemical compound with the molecular formula C18H18O6 and a molecular weight of 330.3 g/mol. IUPAC name: [4-[1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)but-2-ynyl]phenyl] acetate. InChIKey: KTTNZOGALBYSBO-UHFFFAOYSA-N.
| Molecular formula | C18H18O6 |
|---|---|
| Molecular weight | 330.3 g/mol |
| IUPAC name | [4-[1-(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)but-2-ynyl]phenyl] acetate |
| InChIKey | KTTNZOGALBYSBO-UHFFFAOYSA-N |
| SMILES | CC#CC(C1C(=O)OC(OC1=O)(C)C)C2=CC=C(C=C2)OC(=O)C |
Computed by PubChem (NCBI)