CAS 218464-59-6 appears in our catalog under these names: VPC-13566/ 99.37% (existing batch purity), VPC–13566, VPC-13566, VPC-13566 99%, 2-(7-methyl-1H-indol-3-yl)quinoline. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg.
2-(7-methyl-1H-indol-3-yl)quinoline (CAS 218464-59-6) is a chemical compound with the molecular formula C18H14N2 and a molecular weight of 258.3 g/mol. IUPAC name: 2-(7-methyl-1H-indol-3-yl)quinoline. InChIKey: FPKBNOVQNMJTEJ-UHFFFAOYSA-N.
| Molecular formula | C18H14N2 |
|---|---|
| Molecular weight | 258.3 g/mol |
| IUPAC name | 2-(7-methyl-1H-indol-3-yl)quinoline |
| InChIKey | FPKBNOVQNMJTEJ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN2)C3=NC4=CC=CC=C4C=C3 |
Computed by PubChem (NCBI)